C15H22N2O6S — CID 86720399
3-(methanesulfonamidomethyl)-4-(2-morpholin-4-ylethoxy)benzoic acid (PubChem CID 86720399) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-(methanesulfonamidomethyl)-4-(2-morpholin-4-ylethoxy)benzoic acid.
| Compound Name | 3-(methanesulfonamidomethyl)-4-(2-morpholin-4-ylethoxy)benzoic acid |
|---|---|
| PubChem CID | 86720399 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-(methanesulfonamidomethyl)-4-(2-morpholin-4-ylethoxy)benzoic acid |
| SMILES | CS(=O)(=O)NCc1cc(C(=O)O)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C15H22N2O6S/c1-24(20,21)16-11-13-10-12(15(18)19)2-3-14(13)23-9-6-17-4-7-22-8-5-17/h2-3,10,16H,4-9,11H2,1H3,(H,18,19) |
| InChIKey | UDHBBKFUUYOELB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |