C19H29ClN2O4 — CID 122127082
4-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127082) has the molecular formula C19H29ClN2O4 and a molecular weight of 384.90 g/mol. Its IUPAC name is 4-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127082 |
| Molecular Formula | C19H29ClN2O4 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1ccc(OCCN2CCOCC2)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C19H29ClN2O4/c1-19(2,18(23)24)5-6-21-14-15-3-4-17(16(20)13-15)26-12-9-22-7-10-25-11-8-22/h3-4,13,21H,5-12,14H2,1-2H3,(H,23,24) |
| InChIKey | XCMJMAVJDSHHFY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|