C18H27ClN2O4 — CID 122047210
3-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl-methylamino]-2-methylpropanoic acid (PubChem CID 122047210) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is 3-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122047210 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)Cc1ccc(OCCN2CCOCC2)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C18H27ClN2O4/c1-14(18(22)23)12-20(2)13-15-3-4-17(16(19)11-15)25-10-7-21-5-8-24-9-6-21/h3-4,11,14H,5-10,12-13H2,1-2H3,(H,22,23) |
| InChIKey | JTYGBJIVQMPGTQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |