C12H11NO3S — CID 76848466
acetyl 3-(1,3-benzothiazol-5-yl)propanoate (PubChem CID 76848466) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is acetyl 3-(1,3-benzothiazol-5-yl)propanoate.
| Compound Name | acetyl 3-(1,3-benzothiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 76848466 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | acetyl 3-(1,3-benzothiazol-5-yl)propanoate |
| SMILES | CC(=O)OC(=O)CCc1ccc2scnc2c1 |
| InChI | InChI=1S/C12H11NO3S/c1-8(14)16-12(15)5-3-9-2-4-11-10(6-9)13-7-17-11/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | PNGUUMVSDFJZGV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|