C17H16BrNO3S2 — CID 91382681
4-(1,3-benzothiazol-5-yl)-1-(4-bromophenyl)butane-2-sulfonic acid (PubChem CID 91382681) has the molecular formula C17H16BrNO3S2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-5-yl)-1-(4-bromophenyl)butane-2-sulfonic acid.
| Compound Name | 4-(1,3-benzothiazol-5-yl)-1-(4-bromophenyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 91382681 |
| Molecular Formula | C17H16BrNO3S2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 4-(1,3-benzothiazol-5-yl)-1-(4-bromophenyl)butane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(CCc1ccc2scnc2c1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrNO3S2/c18-14-5-1-12(2-6-14)9-15(24(20,21)22)7-3-13-4-8-17-16(10-13)19-11-23-17/h1-2,4-6,8,10-11,15H,3,7,9H2,(H,20,21,22) |
| InChIKey | UOMFWAOXERDMTP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|