C15H15NO3S2 — CID 22489
4-methylbenzenesulfonate;3-methyl-1,3-benzothiazol-3-ium (PubChem CID 22489) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 4-methylbenzenesulfonate;3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 22489 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 4-methylbenzenesulfonate;3-methyl-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1csc2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H8NS.C7H8O3S/c1-9-6-10-8-5-3-2-4-7(8)9;1-6-2-4-7(5-3-6)11(8,9)10/h2-6H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | VSLLSCGWLKZXJL-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|