C11H12FNO3S2 — CID 57164265
3-(1,3-benzothiazol-5-yl)-1-fluoro-2-methylpropane-1-sulfonic acid (PubChem CID 57164265) has the molecular formula C11H12FNO3S2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-5-yl)-1-fluoro-2-methylpropane-1-sulfonic acid.
| Compound Name | 3-(1,3-benzothiazol-5-yl)-1-fluoro-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 57164265 |
| Molecular Formula | C11H12FNO3S2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-(1,3-benzothiazol-5-yl)-1-fluoro-2-methylpropane-1-sulfonic acid |
| SMILES | CC(Cc1ccc2scnc2c1)C(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H12FNO3S2/c1-7(11(12)18(14,15)16)4-8-2-3-10-9(5-8)13-6-17-10/h2-3,5-7,11H,4H2,1H3,(H,14,15,16) |
| InChIKey | ZWEJZDKOTSTAKM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|