C11H6N4S — CID 167561437
2-(1,3-benzothiazol-5-ylmethylimino)propanedinitrile (PubChem CID 167561437) has the molecular formula C11H6N4S and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-5-ylmethylimino)propanedinitrile.
| Compound Name | 2-(1,3-benzothiazol-5-ylmethylimino)propanedinitrile |
|---|---|
| PubChem CID | 167561437 |
| Molecular Formula | C11H6N4S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-(1,3-benzothiazol-5-ylmethylimino)propanedinitrile |
| SMILES | N#CC(C#N)=NCc1ccc2scnc2c1 |
| InChI | InChI=1S/C11H6N4S/c12-4-9(5-13)14-6-8-1-2-11-10(3-8)15-7-16-11/h1-3,7H,6H2 |
| InChIKey | DSCBJABESPCYBB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|