C17H9FN4S — CID 167648771
2-[[2-(4-fluorophenyl)-1,3-benzothiazol-6-yl]methylimino]propanedinitrile (PubChem CID 167648771) has the molecular formula C17H9FN4S and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-1,3-benzothiazol-6-yl]methylimino]propanedinitrile.
| Compound Name | 2-[[2-(4-fluorophenyl)-1,3-benzothiazol-6-yl]methylimino]propanedinitrile |
|---|---|
| PubChem CID | 167648771 |
| Molecular Formula | C17H9FN4S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-1,3-benzothiazol-6-yl]methylimino]propanedinitrile |
| SMILES | N#CC(C#N)=NCc1ccc2nc(-c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C17H9FN4S/c18-13-4-2-12(3-5-13)17-22-15-6-1-11(7-16(15)23-17)10-21-14(8-19)9-20/h1-7H,10H2 |
| InChIKey | QGOYUBTXLOXJRS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|