C17H10N6O2S — CID 167710165
N-[6-[(dicyanomethylideneamino)methyl]-1,3-benzothiazol-2-yl]-3-hydroxypyridine-2-carboxamide (PubChem CID 167710165) has the molecular formula C17H10N6O2S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[6-[(dicyanomethylideneamino)methyl]-1,3-benzothiazol-2-yl]-3-hydroxypyridine-2-carboxamide.
| Compound Name | N-[6-[(dicyanomethylideneamino)methyl]-1,3-benzothiazol-2-yl]-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 167710165 |
| Molecular Formula | C17H10N6O2S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[6-[(dicyanomethylideneamino)methyl]-1,3-benzothiazol-2-yl]-3-hydroxypyridine-2-carboxamide |
| SMILES | N#CC(C#N)=NCc1ccc2nc(NC(=O)c3ncccc3O)sc2c1 |
| InChI | InChI=1S/C17H10N6O2S/c18-7-11(8-19)21-9-10-3-4-12-14(6-10)26-17(22-12)23-16(25)15-13(24)2-1-5-20-15/h1-6,24H,9H2,(H,22,23,25) |
| InChIKey | ZRZWZDWLTZHTPK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|