C17H18N6O6S2 — CID 172724800
4-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide;methanesulfonic acid (PubChem CID 172724800) has the molecular formula C17H18N6O6S2 and a molecular weight of 466.50 g/mol. Its IUPAC name is 4-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide;methanesulfonic acid.
| Compound Name | 4-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide;methanesulfonic acid |
|---|---|
| PubChem CID | 172724800 |
| Molecular Formula | C17H18N6O6S2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 4-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)benzamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(N)=NCc1ccc(C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C16H14N6O3S.CH4O3S/c17-15(18)19-8-9-1-3-10(4-2-9)14(23)21-16-20-12-6-5-11(22(24)25)7-13(12)26-16;1-5(2,3)4/h1-7H,8H2,(H4,17,18,19)(H,20,21,23);1H3,(H,2,3,4) |
| InChIKey | GZQUPAOZJFFJQH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 203.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|