C14H9BrINS — CID 95930199
6-(bromomethyl)-2-(4-iodophenyl)-1,3-benzothiazole (PubChem CID 95930199) has the molecular formula C14H9BrINS and a molecular weight of 430.11 g/mol. Its IUPAC name is 6-(bromomethyl)-2-(4-iodophenyl)-1,3-benzothiazole.
| Compound Name | 6-(bromomethyl)-2-(4-iodophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 95930199 |
| Molecular Formula | C14H9BrINS |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 428.87 |
| IUPAC Name | 6-(bromomethyl)-2-(4-iodophenyl)-1,3-benzothiazole |
| SMILES | BrCc1ccc2nc(-c3ccc(I)cc3)sc2c1 |
| InChI | InChI=1S/C14H9BrINS/c15-8-9-1-6-12-13(7-9)18-14(17-12)10-2-4-11(16)5-3-10/h1-7H,8H2 |
| InChIKey | ZYUXIJINYAYVPT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|