C14H8Cl3NS — CID 95909765
6-(chloromethyl)-2-(3,4-dichlorophenyl)-1,3-benzothiazole (PubChem CID 95909765) has the molecular formula C14H8Cl3NS and a molecular weight of 328.65 g/mol. Its IUPAC name is 6-(chloromethyl)-2-(3,4-dichlorophenyl)-1,3-benzothiazole.
| Compound Name | 6-(chloromethyl)-2-(3,4-dichlorophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 95909765 |
| Molecular Formula | C14H8Cl3NS |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 6-(chloromethyl)-2-(3,4-dichlorophenyl)-1,3-benzothiazole |
| SMILES | ClCc1ccc2nc(-c3ccc(Cl)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C14H8Cl3NS/c15-7-8-1-4-12-13(5-8)19-14(18-12)9-2-3-10(16)11(17)6-9/h1-6H,7H2 |
| InChIKey | LDYSLHGMYSZZJS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|