C26H31N3O2 — CID 174747028
5,5,5-tris[3-(aminomethyl)phenyl]pentanoic acid (PubChem CID 174747028) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5,5,5-tris[3-(aminomethyl)phenyl]pentanoic acid.
| Compound Name | 5,5,5-tris[3-(aminomethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 174747028 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 5,5,5-tris[3-(aminomethyl)phenyl]pentanoic acid |
| SMILES | NCc1cccc(C(CCCC(=O)O)(c2cccc(CN)c2)c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C26H31N3O2/c27-16-19-5-1-8-22(13-19)26(12-4-11-25(30)31,23-9-2-6-20(14-23)17-28)24-10-3-7-21(15-24)18-29/h1-3,5-10,13-15H,4,11-12,16-18,27-29H2,(H,30,31) |
| InChIKey | IKIOJCDHVCVAPU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|