C25H45N3O4 — CID 70544176
2,2-bis[2-(diethylamino)ethyl]hexanedioic acid;phenylmethanamine (PubChem CID 70544176) has the molecular formula C25H45N3O4 and a molecular weight of 451.65 g/mol. Its IUPAC name is 2,2-bis[2-(diethylamino)ethyl]hexanedioic acid;phenylmethanamine.
| Compound Name | 2,2-bis[2-(diethylamino)ethyl]hexanedioic acid;phenylmethanamine |
|---|---|
| PubChem CID | 70544176 |
| Molecular Formula | C25H45N3O4 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.34 |
| IUPAC Name | 2,2-bis[2-(diethylamino)ethyl]hexanedioic acid;phenylmethanamine |
| SMILES | CCN(CC)CCC(CCCC(=O)O)(CCN(CC)CC)C(=O)O.NCc1ccccc1 |
| InChI | InChI=1S/C18H36N2O4.C7H9N/c1-5-19(6-2)14-12-18(17(23)24,11-9-10-16(21)22)13-15-20(7-3)8-4;8-6-7-4-2-1-3-5-7/h5-15H2,1-4H3,(H,21,22)(H,23,24);1-5H,6,8H2 |
| InChIKey | JYLQLFVHAFXJRB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |