C6H6BrF2N3 — CID 119017284
6-bromo-3-(difluoromethyl)pyridine-2,5-diamine (PubChem CID 119017284) has the molecular formula C6H6BrF2N3 and a molecular weight of 238.03 g/mol. Its IUPAC name is 6-bromo-3-(difluoromethyl)pyridine-2,5-diamine.
| Compound Name | 6-bromo-3-(difluoromethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 119017284 |
| Molecular Formula | C6H6BrF2N3 |
| Molecular Weight | 238.03 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 6-bromo-3-(difluoromethyl)pyridine-2,5-diamine |
| SMILES | Nc1cc(C(F)F)c(N)nc1Br |
| InChI | InChI=1S/C6H6BrF2N3/c7-4-3(10)1-2(5(8)9)6(11)12-4/h1,5H,10H2,(H2,11,12) |
| InChIKey | ZDHUWSLIYJYADL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.03 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|