C6H6F2IN3 — CID 118990847
5-(difluoromethyl)-6-iodopyridine-2,3-diamine (PubChem CID 118990847) has the molecular formula C6H6F2IN3 and a molecular weight of 285.04 g/mol. Its IUPAC name is 5-(difluoromethyl)-6-iodopyridine-2,3-diamine.
| Compound Name | 5-(difluoromethyl)-6-iodopyridine-2,3-diamine |
|---|---|
| PubChem CID | 118990847 |
| Molecular Formula | C6H6F2IN3 |
| Molecular Weight | 285.04 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 5-(difluoromethyl)-6-iodopyridine-2,3-diamine |
| SMILES | Nc1cc(C(F)F)c(I)nc1N |
| InChI | InChI=1S/C6H6F2IN3/c7-4(8)2-1-3(10)6(11)12-5(2)9/h1,4H,10H2,(H2,11,12) |
| InChIKey | JNWWYJKSJBVVJX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.04 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|