C7H4BrF5N2O — CID 119009809
6-bromo-3-(difluoromethyl)-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 119009809) has the molecular formula C7H4BrF5N2O and a molecular weight of 307.02 g/mol. Its IUPAC name is 6-bromo-3-(difluoromethyl)-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 6-bromo-3-(difluoromethyl)-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 119009809 |
| Molecular Formula | C7H4BrF5N2O |
| Molecular Weight | 307.02 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 6-bromo-3-(difluoromethyl)-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | Nc1nc(Br)c(OC(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C7H4BrF5N2O/c8-4-3(16-7(11,12)13)1-2(5(9)10)6(14)15-4/h1,5H,(H2,14,15) |
| InChIKey | WTTDOEHCBBEQHO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.02 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|