C7H9F2N3O — CID 130098756
[3,4-diamino-6-(difluoromethyl)-2-pyridinyl]methanol (PubChem CID 130098756) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is [3,4-diamino-6-(difluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [3,4-diamino-6-(difluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130098756 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | [3,4-diamino-6-(difluoromethyl)-2-pyridinyl]methanol |
| SMILES | Nc1cc(C(F)F)nc(CO)c1N |
| InChI | InChI=1S/C7H9F2N3O/c8-7(9)4-1-3(10)6(11)5(2-13)12-4/h1,7,13H,2,11H2,(H2,10,12) |
| InChIKey | NVDCJTYOGPWGEL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |