C9H11F2NO — CID 130101372
[6-(difluoromethyl)-2,4-dimethyl-3-pyridinyl]methanol (PubChem CID 130101372) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is [6-(difluoromethyl)-2,4-dimethyl-3-pyridinyl]methanol.
| Compound Name | [6-(difluoromethyl)-2,4-dimethyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 130101372 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | [6-(difluoromethyl)-2,4-dimethyl-3-pyridinyl]methanol |
| SMILES | Cc1cc(C(F)F)nc(C)c1CO |
| InChI | InChI=1S/C9H11F2NO/c1-5-3-8(9(10)11)12-6(2)7(5)4-13/h3,9,13H,4H2,1-2H3 |
| InChIKey | CHYSEZDJWJBOAH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |