C7H7F2N3O3 — CID 119006327
[2-amino-6-(difluoromethyl)-4-nitro-3-pyridinyl]methanol (PubChem CID 119006327) has the molecular formula C7H7F2N3O3 and a molecular weight of 219.15 g/mol. Its IUPAC name is [2-amino-6-(difluoromethyl)-4-nitro-3-pyridinyl]methanol.
| Compound Name | [2-amino-6-(difluoromethyl)-4-nitro-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 119006327 |
| Molecular Formula | C7H7F2N3O3 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | [2-amino-6-(difluoromethyl)-4-nitro-3-pyridinyl]methanol |
| SMILES | Nc1nc(C(F)F)cc([N+](=O)[O-])c1CO |
| InChI | InChI=1S/C7H7F2N3O3/c8-6(9)4-1-5(12(14)15)3(2-13)7(10)11-4/h1,6,13H,2H2,(H2,10,11) |
| InChIKey | XEEVAOKYYXNMRW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|