C7H8F3N3 — CID 119000355
3-(aminomethyl)-6-(difluoromethyl)-4-fluoropyridin-2-amine (PubChem CID 119000355) has the molecular formula C7H8F3N3 and a molecular weight of 191.16 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(difluoromethyl)-4-fluoropyridin-2-amine.
| Compound Name | 3-(aminomethyl)-6-(difluoromethyl)-4-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 119000355 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 3-(aminomethyl)-6-(difluoromethyl)-4-fluoropyridin-2-amine |
| SMILES | NCc1c(F)cc(C(F)F)nc1N |
| InChI | InChI=1S/C7H8F3N3/c8-4-1-5(6(9)10)13-7(12)3(4)2-11/h1,6H,2,11H2,(H2,12,13) |
| InChIKey | AIHDUIAIEJYMRT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |