C7H6BrF3N2 — CID 118999277
4-(bromomethyl)-6-(difluoromethyl)-3-fluoropyridin-2-amine (PubChem CID 118999277) has the molecular formula C7H6BrF3N2 and a molecular weight of 255.04 g/mol. Its IUPAC name is 4-(bromomethyl)-6-(difluoromethyl)-3-fluoropyridin-2-amine.
| Compound Name | 4-(bromomethyl)-6-(difluoromethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 118999277 |
| Molecular Formula | C7H6BrF3N2 |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 4-(bromomethyl)-6-(difluoromethyl)-3-fluoropyridin-2-amine |
| SMILES | Nc1nc(C(F)F)cc(CBr)c1F |
| InChI | InChI=1S/C7H6BrF3N2/c8-2-3-1-4(6(10)11)13-7(12)5(3)9/h1,6H,2H2,(H2,12,13) |
| InChIKey | SPRJSJULMLQSDD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|