C8H8F2N2O3 — CID 130104973
methyl 4-amino-6-(difluoromethyl)-3-hydroxypyridine-2-carboxylate (PubChem CID 130104973) has the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. Its IUPAC name is methyl 4-amino-6-(difluoromethyl)-3-hydroxypyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(difluoromethyl)-3-hydroxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 130104973 |
| Molecular Formula | C8H8F2N2O3 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | methyl 4-amino-6-(difluoromethyl)-3-hydroxypyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C(F)F)cc(N)c1O |
| InChI | InChI=1S/C8H8F2N2O3/c1-15-8(14)5-6(13)3(11)2-4(12-5)7(9)10/h2,7,13H,1H3,(H2,11,12) |
| InChIKey | MQKWMYOMXCZPGZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |