C9H7F5N2O2 — CID 134684128
methyl 3-amino-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134684128) has the molecular formula C9H7F5N2O2 and a molecular weight of 270.16 g/mol. Its IUPAC name is methyl 3-amino-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-amino-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134684128 |
| Molecular Formula | C9H7F5N2O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | methyl 3-amino-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C(F)F)cc(C(F)(F)F)c1N |
| InChI | InChI=1S/C9H7F5N2O2/c1-18-8(17)6-5(15)3(9(12,13)14)2-4(16-6)7(10)11/h2,7H,15H2,1H3 |
| InChIKey | ODLMQFYDOFXRCS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |