C9H5F5INO2 — CID 133100965
methyl 6-(difluoromethyl)-3-iodo-2-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 133100965) has the molecular formula C9H5F5INO2 and a molecular weight of 381.04 g/mol. Its IUPAC name is methyl 6-(difluoromethyl)-3-iodo-2-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | methyl 6-(difluoromethyl)-3-iodo-2-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 133100965 |
| Molecular Formula | C9H5F5INO2 |
| Molecular Weight | 381.04 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | methyl 6-(difluoromethyl)-3-iodo-2-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(C(F)F)nc(C(F)(F)F)c1I |
| InChI | InChI=1S/C9H5F5INO2/c1-18-8(17)3-2-4(7(10)11)16-6(5(3)15)9(12,13)14/h2,7H,1H3 |
| InChIKey | IHQYBZWOFBXHNM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|