C12H4Cl4F3N — CID 134636029
3-chloro-2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)pyridine (PubChem CID 134636029) has the molecular formula C12H4Cl4F3N and a molecular weight of 360.98 g/mol. Its IUPAC name is 3-chloro-2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134636029 |
| Molecular Formula | C12H4Cl4F3N |
| Molecular Weight | 360.98 g/mol |
| Exact Mass | 358.90 |
| IUPAC Name | 3-chloro-2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(Cl)c(-c2ccc(Cl)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H4Cl4F3N/c13-6-2-1-5(9(15)10(6)16)11-7(14)3-4-8(20-11)12(17,18)19/h1-4H |
| InChIKey | AMDGNTZWVOIKHY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.98 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|