C14H7Cl3F3NO2 — CID 118807924
2-[2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]acetic acid (PubChem CID 118807924) has the molecular formula C14H7Cl3F3NO2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118807924 |
| Molecular Formula | C14H7Cl3F3NO2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 2-[2-(2,3,4-trichlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc(Cl)c(Cl)c2Cl)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H7Cl3F3NO2/c15-8-2-1-7(12(16)13(8)17)9-3-6(5-11(22)23)4-10(21-9)14(18,19)20/h1-4H,5H2,(H,22,23) |
| InChIKey | IEFTYFGBEFPAPN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|