C13H7Cl3FNO2 — CID 133090375
2-[2-fluoro-5-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid (PubChem CID 133090375) has the molecular formula C13H7Cl3FNO2 and a molecular weight of 334.56 g/mol. Its IUPAC name is 2-[2-fluoro-5-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133090375 |
| Molecular Formula | C13H7Cl3FNO2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 2-[2-fluoro-5-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc(Cl)c(Cl)c2Cl)cnc1F |
| InChI | InChI=1S/C13H7Cl3FNO2/c14-9-2-1-8(11(15)12(9)16)7-3-6(4-10(19)20)13(17)18-5-7/h1-3,5H,4H2,(H,19,20) |
| InChIKey | JJNQDJYZFGKBNL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|