2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid

C13H7Cl3FNO2 — CID 133090411

IUPAC2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid
SMILESO=C(O)Cc1ncc(F)cc1-c1ccc(Cl)c(Cl)c1Cl
InChIInChI=1S/C13H7Cl3FNO2/c14-9-2-1-7(12(15)13(9)16)8-3-6(17)5-18-10(8)4-11(19)20/h1-3,5H,4H2,(H,19,20)
InChIKeyXAUDLJZFUYZUCD-UHFFFAOYSA-N
MW334.56 g/mol
LogP4.47
Rot. Bonds3

About 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid

2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid (PubChem CID 133090411) has the molecular formula C13H7Cl3FNO2 and a molecular weight of 334.56 g/mol. Its IUPAC name is 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid.

Molecular Properties

Compound Name2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid
PubChem CID133090411
Molecular FormulaC13H7Cl3FNO2
Molecular Weight334.56 g/mol
Exact Mass332.95
IUPAC Name2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid
SMILESO=C(O)Cc1ncc(F)cc1-c1ccc(Cl)c(Cl)c1Cl
InChIInChI=1S/C13H7Cl3FNO2/c14-9-2-1-7(12(15)13(9)16)8-3-6(17)5-18-10(8)4-11(19)20/h1-3,5H,4H2,(H,19,20)
InChIKeyXAUDLJZFUYZUCD-UHFFFAOYSA-N
XLogP4.47
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.56
LogP ≤ 54.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid?
The IUPAC name of 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid (CID 133090411) is 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid.
What is the SMILES notation for 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid?
The canonical SMILES for 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid is O=C(O)Cc1ncc(F)cc1-c1ccc(Cl)c(Cl)c1Cl.
What is the InChIKey of 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid?
The InChIKey is XAUDLJZFUYZUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl3FNO2/c14-9-2-1-7(12(15)13(9)16)8-3-6(17)5-18-10(8)4-11(19)20/h1-3,5H,4H2,(H,19,20).
What are the key properties of 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid?
2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid has a molecular weight of 334.56 g/mol, XLogP of 4.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-fluoro-3-(2,3,4-trichlorophenyl)-2-pyridinyl]acetic acid is sourced from PubChem (CID 133090411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).