C13H7Cl4NO2 — CID 134635967
2-[6-chloro-2-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid (PubChem CID 134635967) has the molecular formula C13H7Cl4NO2 and a molecular weight of 351.02 g/mol. Its IUPAC name is 2-[6-chloro-2-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-chloro-2-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134635967 |
| Molecular Formula | C13H7Cl4NO2 |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 2-[6-chloro-2-(2,3,4-trichlorophenyl)-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Cl)nc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl4NO2/c14-8-3-2-7(11(16)12(8)17)13-6(5-10(19)20)1-4-9(15)18-13/h1-4H,5H2,(H,19,20) |
| InChIKey | SYLDEHZEGNLAMV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|