C13H6Cl2F3NO — CID 170837769
2-(2,5-dichlorophenyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde (PubChem CID 170837769) has the molecular formula C13H6Cl2F3NO and a molecular weight of 320.10 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde.
| Compound Name | 2-(2,5-dichlorophenyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 170837769 |
| Molecular Formula | C13H6Cl2F3NO |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde |
| SMILES | O=Cc1cc(-c2cc(Cl)ccc2Cl)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6Cl2F3NO/c14-8-1-2-10(15)9(5-8)11-3-7(6-20)4-12(19-11)13(16,17)18/h1-6H |
| InChIKey | MJNQHOITRKGQDF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|