C13H10F4N2 — CID 118008047
[3-fluoro-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine (PubChem CID 118008047) has the molecular formula C13H10F4N2 and a molecular weight of 270.23 g/mol. Its IUPAC name is [3-fluoro-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine.
| Compound Name | [3-fluoro-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine |
|---|---|
| PubChem CID | 118008047 |
| Molecular Formula | C13H10F4N2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [3-fluoro-5-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine |
| SMILES | NCc1cc(F)cc(-c2ccc(C(F)(F)F)nc2)c1 |
| InChI | InChI=1S/C13H10F4N2/c14-11-4-8(6-18)3-10(5-11)9-1-2-12(19-7-9)13(15,16)17/h1-5,7H,6,18H2 |
| InChIKey | ASNFBEMNFKVHRY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |