C13H14F5N3 — CID 159348275
2,3-difluoropyridine;methane;[6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 159348275) has the molecular formula C13H14F5N3 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2,3-difluoropyridine;methane;[6-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | 2,3-difluoropyridine;methane;[6-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 159348275 |
| Molecular Formula | C13H14F5N3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2,3-difluoropyridine;methane;[6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | C.Fc1cccnc1F.NCc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C7H7F3N2.C5H3F2N.CH4/c8-7(9,10)6-2-1-5(3-11)4-12-6;6-4-2-1-3-8-5(4)7;/h1-2,4H,3,11H2;1-3H;1H4 |
| InChIKey | LGZSOAKRQZICKH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|