C10H8I3N2O4S- — CID 153287290
(1E)-N-methylsulfonyl-2-[(2,3,5-triiodobenzoyl)amino]ethanimidate (PubChem CID 153287290) has the molecular formula C10H8I3N2O4S- and a molecular weight of 632.96 g/mol. Its IUPAC name is (1E)-N-methylsulfonyl-2-[(2,3,5-triiodobenzoyl)amino]ethanimidate.
| Compound Name | (1E)-N-methylsulfonyl-2-[(2,3,5-triiodobenzoyl)amino]ethanimidate |
|---|---|
| PubChem CID | 153287290 |
| Molecular Formula | C10H8I3N2O4S- |
| Molecular Weight | 632.96 g/mol |
| Exact Mass | 632.73 |
| IUPAC Name | (1E)-N-methylsulfonyl-2-[(2,3,5-triiodobenzoyl)amino]ethanimidate |
| SMILES | CS(=O)(=O)/N=C(/[O-])CNC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H9I3N2O4S/c1-20(18,19)15-8(16)4-14-10(17)6-2-5(11)3-7(12)9(6)13/h2-3H,4H2,1H3,(H,14,17)(H,15,16)/p-1 |
| InChIKey | IWMNOMDTYDWIMS-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.96 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|