C15H15I3NO5S- — CID 153287315
(1E)-N-methylsulfonyl-3-(2,3,5-triiodobenzoyl)oxycyclohexane-1-carboximidate (PubChem CID 153287315) has the molecular formula C15H15I3NO5S- and a molecular weight of 702.07 g/mol. Its IUPAC name is (1E)-N-methylsulfonyl-3-(2,3,5-triiodobenzoyl)oxycyclohexane-1-carboximidate.
| Compound Name | (1E)-N-methylsulfonyl-3-(2,3,5-triiodobenzoyl)oxycyclohexane-1-carboximidate |
|---|---|
| PubChem CID | 153287315 |
| Molecular Formula | C15H15I3NO5S- |
| Molecular Weight | 702.07 g/mol |
| Exact Mass | 701.78 |
| IUPAC Name | (1E)-N-methylsulfonyl-3-(2,3,5-triiodobenzoyl)oxycyclohexane-1-carboximidate |
| SMILES | CS(=O)(=O)/N=C(/[O-])C1CCCC(OC(=O)c2cc(I)cc(I)c2I)C1 |
| InChI | InChI=1S/C15H16I3NO5S/c1-25(22,23)19-14(20)8-3-2-4-10(5-8)24-15(21)11-6-9(16)7-12(17)13(11)18/h6-8,10H,2-5H2,1H3,(H,19,20)/p-1 |
| InChIKey | NEPMCFHPDJRCHJ-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 95.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.07 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|