C12H12I3NO2 — CID 155784661
piperidin-4-yl 2,3,5-triiodobenzoate (PubChem CID 155784661) has the molecular formula C12H12I3NO2 and a molecular weight of 582.95 g/mol. Its IUPAC name is piperidin-4-yl 2,3,5-triiodobenzoate.
| Compound Name | piperidin-4-yl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 155784661 |
| Molecular Formula | C12H12I3NO2 |
| Molecular Weight | 582.95 g/mol |
| Exact Mass | 582.80 |
| IUPAC Name | piperidin-4-yl 2,3,5-triiodobenzoate |
| SMILES | O=C(OC1CCNCC1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C12H12I3NO2/c13-7-5-9(11(15)10(14)6-7)12(17)18-8-1-3-16-4-2-8/h5-6,8,16H,1-4H2 |
| InChIKey | RNYPJLVLSDBBAH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.95 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|