C14H15I3NO2+ — CID 155784628
1-azoniabicyclo[2.2.2]octan-3-yl 2,3,5-triiodobenzoate (PubChem CID 155784628) has the molecular formula C14H15I3NO2+ and a molecular weight of 609.99 g/mol. Its IUPAC name is 1-azoniabicyclo[2.2.2]octan-3-yl 2,3,5-triiodobenzoate.
| Compound Name | 1-azoniabicyclo[2.2.2]octan-3-yl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 155784628 |
| Molecular Formula | C14H15I3NO2+ |
| Molecular Weight | 609.99 g/mol |
| Exact Mass | 609.82 |
| IUPAC Name | 1-azoniabicyclo[2.2.2]octan-3-yl 2,3,5-triiodobenzoate |
| SMILES | O=C(OC1C[NH+]2CCC1CC2)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H14I3NO2/c15-9-5-10(13(17)11(16)6-9)14(19)20-12-7-18-3-1-8(12)2-4-18/h5-6,8,12H,1-4,7H2/p+1 |
| InChIKey | PWAHVYHTSZXUNK-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.99 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|