C17H18I3NO6 — CID 170393049
(6-methyl-1,4,8,11-tetraoxa-6-azadispiro[4.1.47.35]tetradecan-13-yl) 2,3,5-triiodobenzoate (PubChem CID 170393049) has the molecular formula C17H18I3NO6 and a molecular weight of 713.04 g/mol. Its IUPAC name is (6-methyl-1,4,8,11-tetraoxa-6-azadispiro[4.1.47.35]tetradecan-13-yl) 2,3,5-triiodobenzoate.
| Compound Name | (6-methyl-1,4,8,11-tetraoxa-6-azadispiro[4.1.47.35]tetradecan-13-yl) 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 170393049 |
| Molecular Formula | C17H18I3NO6 |
| Molecular Weight | 713.04 g/mol |
| Exact Mass | 712.83 |
| IUPAC Name | (6-methyl-1,4,8,11-tetraoxa-6-azadispiro[4.1.47.35]tetradecan-13-yl) 2,3,5-triiodobenzoate |
| SMILES | CN1C2(CC(OC(=O)c3cc(I)cc(I)c3I)CC13OCCO3)OCCO2 |
| InChI | InChI=1S/C17H18I3NO6/c1-21-16(23-2-3-24-16)8-11(9-17(21)25-4-5-26-17)27-15(22)12-6-10(18)7-13(19)14(12)20/h6-7,11H,2-5,8-9H2,1H3 |
| InChIKey | NNMOCCRPIGLKCY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.04 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|