C27H33I2NO5 — CID 170393172
2-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylphenyl]propan-2-yl 2-hydroxy-3,5-diiodobenzoate (PubChem CID 170393172) has the molecular formula C27H33I2NO5 and a molecular weight of 705.37 g/mol. Its IUPAC name is 2-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylphenyl]propan-2-yl 2-hydroxy-3,5-diiodobenzoate.
| Compound Name | 2-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylphenyl]propan-2-yl 2-hydroxy-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 170393172 |
| Molecular Formula | C27H33I2NO5 |
| Molecular Weight | 705.37 g/mol |
| Exact Mass | 705.04 |
| IUPAC Name | 2-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylphenyl]propan-2-yl 2-hydroxy-3,5-diiodobenzoate |
| SMILES | CN1C(C)(C)CC(OC(=O)c2ccc(C(C)(C)OC(=O)c3cc(I)cc(I)c3O)cc2)CC1(C)C |
| InChI | InChI=1S/C27H33I2NO5/c1-25(2)14-19(15-26(3,4)30(25)7)34-23(32)16-8-10-17(11-9-16)27(5,6)35-24(33)20-12-18(28)13-21(29)22(20)31/h8-13,19,31H,14-15H2,1-7H3 |
| InChIKey | ONKSUNMAGVMJMY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.37 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|