C18H24I3NO2 — CID 154609295
2-(1,2,6-trimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate (PubChem CID 154609295) has the molecular formula C18H24I3NO2 and a molecular weight of 667.11 g/mol. Its IUPAC name is 2-(1,2,6-trimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate.
| Compound Name | 2-(1,2,6-trimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 154609295 |
| Molecular Formula | C18H24I3NO2 |
| Molecular Weight | 667.11 g/mol |
| Exact Mass | 666.89 |
| IUPAC Name | 2-(1,2,6-trimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
| SMILES | CC1CC(C(C)(C)OC(=O)c2cc(I)cc(I)c2I)CC(C)N1C |
| InChI | InChI=1S/C18H24I3NO2/c1-10-6-12(7-11(2)22(10)5)18(3,4)24-17(23)14-8-13(19)9-15(20)16(14)21/h8-12H,6-7H2,1-5H3 |
| InChIKey | IYMDHFTYYFBRBO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.11 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|