C15H19BrINO2 — CID 154609291
2-piperidin-4-ylpropan-2-yl 2-bromo-5-iodobenzoate (PubChem CID 154609291) has the molecular formula C15H19BrINO2 and a molecular weight of 452.13 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-bromo-5-iodobenzoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-bromo-5-iodobenzoate |
|---|---|
| PubChem CID | 154609291 |
| Molecular Formula | C15H19BrINO2 |
| Molecular Weight | 452.13 g/mol |
| Exact Mass | 450.96 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-bromo-5-iodobenzoate |
| SMILES | CC(C)(OC(=O)c1cc(I)ccc1Br)C1CCNCC1 |
| InChI | InChI=1S/C15H19BrINO2/c1-15(2,10-5-7-18-8-6-10)20-14(19)12-9-11(17)3-4-13(12)16/h3-4,9-10,18H,5-8H2,1-2H3 |
| InChIKey | GNENJEQMELJKDR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.13 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|