C16H22BrNO2 — CID 155605314
2-piperidin-4-ylpropan-2-yl 4-bromo-3-methylbenzoate (PubChem CID 155605314) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 4-bromo-3-methylbenzoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 4-bromo-3-methylbenzoate |
|---|---|
| PubChem CID | 155605314 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 4-bromo-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OC(C)(C)C2CCNCC2)ccc1Br |
| InChI | InChI=1S/C16H22BrNO2/c1-11-10-12(4-5-14(11)17)15(19)20-16(2,3)13-6-8-18-9-7-13/h4-5,10,13,18H,6-9H2,1-3H3 |
| InChIKey | XOCXQWGTXTXRBX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |