C15H19Cl2NO2 — CID 155075487
2-piperidin-4-ylpropan-2-yl 3,4-dichlorobenzoate (PubChem CID 155075487) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 3,4-dichlorobenzoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 155075487 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 3,4-dichlorobenzoate |
| SMILES | CC(C)(OC(=O)c1ccc(Cl)c(Cl)c1)C1CCNCC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-15(2,11-5-7-18-8-6-11)20-14(19)10-3-4-12(16)13(17)9-10/h3-4,9,11,18H,5-8H2,1-2H3 |
| InChIKey | KZHVHVJBHPQZOC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |