About bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate
bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate (PubChem CID 155605322) has the molecular formula C24H35BrN2O4
and a molecular weight of 495.46 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate |
| PubChem CID | 155605322 |
| Molecular Formula | C24H35BrN2O4 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate |
| SMILES | CC(C)(OC(=O)c1ccc(Br)c(C(=O)OC(C)(C)C2CCNCC2)c1)C1CCNCC1 |
| InChI | InChI=1S/C24H35BrN2O4/c1-23(2,17-7-11-26-12-8-17)30-21(28)16-5-6-20(25)19(15-16)22(29)31-24(3,4)18-9-13-27-14-10-18/h5-6,15,17-18,26-27H,7-14H2,1-4H3 |
| InChIKey | JSHDDMDMYYBQRQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate?
The IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate (CID 155605322) is bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate.
What is the SMILES notation for bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate?
The canonical SMILES for bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate is CC(C)(OC(=O)c1ccc(Br)c(C(=O)OC(C)(C)C2CCNCC2)c1)C1CCNCC1.
What is the InChIKey of bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate?
The InChIKey is JSHDDMDMYYBQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35BrN2O4/c1-23(2,17-7-11-26-12-8-17)30-21(28)16-5-6-20(25)19(15-16)22(29)31-24(3,4)18-9-13-27-14-10-18/h5-6,15,17-18,26-27H,7-14H2,1-4H3.
What are the key properties of bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate?
bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate has a molecular weight of 495.46 g/mol, XLogP of 4.32, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-piperidin-4-ylpropan-2-yl) 4-bromobenzene-1,3-dicarboxylate is sourced from PubChem (CID 155605322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).