C17H23I3NO2+ — CID 154609352
2-(2,6-dimethylpiperidin-1-ium-4-yl)propan-2-yl 2,3,5-triiodobenzoate (PubChem CID 154609352) has the molecular formula C17H23I3NO2+ and a molecular weight of 654.09 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-ium-4-yl)propan-2-yl 2,3,5-triiodobenzoate.
| Compound Name | 2-(2,6-dimethylpiperidin-1-ium-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 154609352 |
| Molecular Formula | C17H23I3NO2+ |
| Molecular Weight | 654.09 g/mol |
| Exact Mass | 653.89 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-ium-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
| SMILES | CC1CC(C(C)(C)OC(=O)c2cc(I)cc(I)c2I)CC(C)[NH2+]1 |
| InChI | InChI=1S/C17H22I3NO2/c1-9-5-11(6-10(2)21-9)17(3,4)23-16(22)13-7-12(18)8-14(19)15(13)20/h7-11,21H,5-6H2,1-4H3/p+1 |
| InChIKey | XHCVHPWEOIUTHE-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.09 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|