C16H20I3NO2 — CID 154609203
2-(1-methylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate (PubChem CID 154609203) has the molecular formula C16H20I3NO2 and a molecular weight of 639.05 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate.
| Compound Name | 2-(1-methylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 154609203 |
| Molecular Formula | C16H20I3NO2 |
| Molecular Weight | 639.05 g/mol |
| Exact Mass | 638.86 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
| SMILES | CN1CCC(C(C)(C)OC(=O)c2cc(I)cc(I)c2I)CC1 |
| InChI | InChI=1S/C16H20I3NO2/c1-16(2,10-4-6-20(3)7-5-10)22-15(21)12-8-11(17)9-13(18)14(12)19/h8-10H,4-7H2,1-3H3 |
| InChIKey | SRESCQFHDLTFSF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.05 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|