C15H14F3I3NO4S- — CID 162466934
trifluoromethylsulfonyl-[[4-(2,3,5-triiodobenzoyl)oxycyclohexyl]methyl]azanide (PubChem CID 162466934) has the molecular formula C15H14F3I3NO4S- and a molecular weight of 742.05 g/mol. Its IUPAC name is trifluoromethylsulfonyl-[[4-(2,3,5-triiodobenzoyl)oxycyclohexyl]methyl]azanide.
| Compound Name | trifluoromethylsulfonyl-[[4-(2,3,5-triiodobenzoyl)oxycyclohexyl]methyl]azanide |
|---|---|
| PubChem CID | 162466934 |
| Molecular Formula | C15H14F3I3NO4S- |
| Molecular Weight | 742.05 g/mol |
| Exact Mass | 741.77 |
| IUPAC Name | trifluoromethylsulfonyl-[[4-(2,3,5-triiodobenzoyl)oxycyclohexyl]methyl]azanide |
| SMILES | O=C(OC1CCC(C[N-]S(=O)(=O)C(F)(F)F)CC1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C15H14F3I3NO4S/c16-15(17,18)27(24,25)22-7-8-1-3-10(4-2-8)26-14(23)11-5-9(19)6-12(20)13(11)21/h5-6,8,10H,1-4,7H2/q-1 |
| InChIKey | PMQPHDWPJTVOLO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.05 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|