About (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate
(1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate (PubChem CID 155649877) has the molecular formula C8H6I2NO3S-
and a molecular weight of 450.02 g/mol. Its IUPAC name is (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate.
Molecular Properties
| Compound Name | (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate |
| PubChem CID | 155649877 |
| Molecular Formula | C8H6I2NO3S- |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.82 |
| IUPAC Name | (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate |
| SMILES | CS(=O)(=O)/N=C(\[O-])c1c(I)cccc1I |
| InChI | InChI=1S/C8H7I2NO3S/c1-15(13,14)11-8(12)7-5(9)3-2-4-6(7)10/h2-4H,1H3,(H,11,12)/p-1 |
| InChIKey | ATXBSKVGCPQMOG-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate?
The IUPAC name of (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate (CID 155649877) is (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate.
What is the SMILES notation for (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate?
The canonical SMILES for (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate is CS(=O)(=O)/N=C(\[O-])c1c(I)cccc1I.
What is the InChIKey of (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate?
The InChIKey is ATXBSKVGCPQMOG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7I2NO3S/c1-15(13,14)11-8(12)7-5(9)3-2-4-6(7)10/h2-4H,1H3,(H,11,12)/p-1.
What are the key properties of (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate?
(1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate has a molecular weight of 450.02 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2,6-diiodo-N-methylsulfonylbenzenecarboximidate is sourced from PubChem (CID 155649877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).