About 2-[(2,3,5-triiodophenyl)methoxy]acetic acid
2-[(2,3,5-triiodophenyl)methoxy]acetic acid (PubChem CID 71054031) has the molecular formula C9H7I3O3
and a molecular weight of 543.86 g/mol. Its IUPAC name is 2-[(2,3,5-triiodophenyl)methoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[(2,3,5-triiodophenyl)methoxy]acetic acid |
| PubChem CID | 71054031 |
| Molecular Formula | C9H7I3O3 |
| Molecular Weight | 543.86 g/mol |
| Exact Mass | 543.75 |
| IUPAC Name | 2-[(2,3,5-triiodophenyl)methoxy]acetic acid |
| SMILES | O=C(O)COCc1cc(I)cc(I)c1I |
| InChI | InChI=1S/C9H7I3O3/c10-6-1-5(3-15-4-8(13)14)9(12)7(11)2-6/h1-2H,3-4H2,(H,13,14) |
| InChIKey | SWEWBQXMAAGWAM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,3,5-triiodophenyl)methoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3,5-triiodophenyl)methoxy]acetic acid?
The IUPAC name of 2-[(2,3,5-triiodophenyl)methoxy]acetic acid (CID 71054031) is 2-[(2,3,5-triiodophenyl)methoxy]acetic acid.
What is the SMILES notation for 2-[(2,3,5-triiodophenyl)methoxy]acetic acid?
The canonical SMILES for 2-[(2,3,5-triiodophenyl)methoxy]acetic acid is O=C(O)COCc1cc(I)cc(I)c1I.
What is the InChIKey of 2-[(2,3,5-triiodophenyl)methoxy]acetic acid?
The InChIKey is SWEWBQXMAAGWAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7I3O3/c10-6-1-5(3-15-4-8(13)14)9(12)7(11)2-6/h1-2H,3-4H2,(H,13,14).
What are the key properties of 2-[(2,3,5-triiodophenyl)methoxy]acetic acid?
2-[(2,3,5-triiodophenyl)methoxy]acetic acid has a molecular weight of 543.86 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3,5-triiodophenyl)methoxy]acetic acid is sourced from PubChem (CID 71054031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).