C9H7I3O3 — CID 71054031
2-[(2,3,5-triiodophenyl)methoxy]acetic acid (PubChem CID 71054031) has the molecular formula C9H7I3O3 and a molecular weight of 543.86 g/mol. Its IUPAC name is 2-[(2,3,5-triiodophenyl)methoxy]acetic acid.
| Compound Name | 2-[(2,3,5-triiodophenyl)methoxy]acetic acid |
|---|---|
| PubChem CID | 71054031 |
| Molecular Formula | C9H7I3O3 |
| Molecular Weight | 543.86 g/mol |
| Exact Mass | 543.75 |
| IUPAC Name | 2-[(2,3,5-triiodophenyl)methoxy]acetic acid |
| SMILES | O=C(O)COCc1cc(I)cc(I)c1I |
| InChI | InChI=1S/C9H7I3O3/c10-6-1-5(3-15-4-8(13)14)9(12)7(11)2-6/h1-2H,3-4H2,(H,13,14) |
| InChIKey | SWEWBQXMAAGWAM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|